2-Methyl-9,10-bis(naphthalen-2-yl)anthracene, 99.5% (CAS 804560-00-7) manufactured by Lumtec in a 1g pack.
| brand | Lumtec |
|---|---|
| catalog number | LT-E410-1g |
| cas | 804560-00-7 |
| size | 1g |
| availability | 12.11.2021: In Stock |
| purity | 99.5% |
|---|
2-methyl-9,10-dinaphthalen-2-ylanthracene (CAS 804560-00-7) is a chemical compound with the molecular formula C35H24 and a molecular weight of 444.6 g/mol. IUPAC name: 2-methyl-9,10-dinaphthalen-2-ylanthracene. InChIKey: HNWFFTUWRIGBNM-UHFFFAOYSA-N.
| Molecular formula | C35H24 |
|---|---|
| Molecular weight | 444.6 g/mol |
| IUPAC name | 2-methyl-9,10-dinaphthalen-2-ylanthracene |
| InChIKey | HNWFFTUWRIGBNM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=CC=CC=C3C(=C2C=C1)C4=CC5=CC=CC=C5C=C4)C6=CC7=CC=CC=C7C=C6 |
Computed by PubChem (NCBI)