2-Methyl-9H-fluoren-9-one, 95%
cas: 2840-51-9 — see every product listed under this CAS number, including other names
2-Methyl-9H-fluoren-9-one, 95% (CAS 2840-51-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A291237-250mg |
| cas | 2840-51-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1221.44 Pln | |
| Ambeed | 5g | 3168.31 Pln | |
| BLDpharm | 100mg | 336.57 Pln | |
| BLDpharm | 250mg | 519.84 Pln | |
| BLDpharm | 1g | 1314.01 Pln | |
| BLDpharm | 5g | 3407.71 Pln | |
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 1g | 1221.20 Pln | |
| Chemat | 5g | 3179.60 Pln | |
| Fluorochem | 100mg | 560.24 Pln | |
| Fluorochem | 250mg | 888.25 Pln | |
| Fluorochem | 1g | 2267.97 Pln | |
| Fluorochem | 5g | 5896.90 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-methylfluoren-9-one (CAS 2840-51-9) is a chemical compound with the molecular formula C14H10O and a molecular weight of 194.23 g/mol. IUPAC name: 2-methylfluoren-9-one. InChIKey: KXXOMIPLRDTZCC-UHFFFAOYSA-N.
| Molecular formula | C14H10O |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-methylfluoren-9-one |
| InChIKey | KXXOMIPLRDTZCC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)