cas: 1628014-71-0 — see every product listed under this CAS number, including other names
2-Methyl-N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)propan-2-amine 98% (CAS 1628014-71-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A477064-1g |
| cas | 1628014-71-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 409.31 Pln | |
| Ambeed | 10g | 743.06 Pln | |
| Ambeed | 25g | 1482.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A477064 |
2-methyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]propan-2-amine (CAS 1628014-71-0) is a chemical compound with the molecular formula C17H28BNO2 and a molecular weight of 289.2 g/mol. IUPAC name: 2-methyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]propan-2-amine. InChIKey: QJBWHEPPDGGWLQ-UHFFFAOYSA-N.
| Molecular formula | C17H28BNO2 |
|---|---|
| Molecular weight | 289.2 g/mol |
| IUPAC name | 2-methyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]propan-2-amine |
| InChIKey | QJBWHEPPDGGWLQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CNC(C)(C)C |
Computed by PubChem (NCBI)