cas: 177080-67-0 — see every product listed under this CAS number, including other names
2-Methyladamantan-2-yl methacrylate, 98% (stabilized with MEHQ), 98% (stabilized with MEHQ) (CAS 177080-67-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11364Q-1g |
| cas | 177080-67-0 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 10g | 251.60 Pln | |
| Chemat | 25g | 438.80 Pln |
| purity | 98% (stabilized with MEHQ) |
|---|---|
| delivery time | 3 weeks |
(2-methyl-2-adamantyl) 2-methylprop-2-enoate (CAS 177080-67-0) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: (2-methyl-2-adamantyl) 2-methylprop-2-enoate. InChIKey: FDYDISGSYGFRJM-UHFFFAOYSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | (2-methyl-2-adamantyl) 2-methylprop-2-enoate |
| InChIKey | FDYDISGSYGFRJM-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1(C2CC3CC(C2)CC1C3)C |
Computed by PubChem (NCBI)