cas: 864274-04-4 — see every product listed under this CAS number, including other names
2-Methylbenzo[d]oxazole-6-carbaldehyde, 97%, 97% (CAS 864274-04-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115NLL-100mg |
| cas | 864274-04-4 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 822.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-methyl-1,3-benzoxazole-6-carbaldehyde (CAS 864274-04-4) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 2-methyl-1,3-benzoxazole-6-carbaldehyde. InChIKey: ICPRUGIXGJLQHU-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 2-methyl-1,3-benzoxazole-6-carbaldehyde |
| InChIKey | ICPRUGIXGJLQHU-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(O1)C=C(C=C2)C=O |
Computed by PubChem (NCBI)