CAS 1233521-02-2 appears in our catalog under these names: 2–Ethynyl–1–methyl–4–nitrobenzene, 2-Ethynyl-1-methyl-4-nitrobenzene, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-ethynyl-1-methyl-4-nitrobenzene (CAS 1233521-02-2) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 2-ethynyl-1-methyl-4-nitrobenzene. InChIKey: SRKFXZQFDIEEDY-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 2-ethynyl-1-methyl-4-nitrobenzene |
| InChIKey | SRKFXZQFDIEEDY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])C#C |
Computed by PubChem (NCBI)