cas: 386715-52-2 — see every product listed under this CAS number, including other names
2-Methylsulfonyl-1-(4-trifluoromethylphenyl)ethanone (CAS 386715-52-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009291-1G |
| cas | 386715-52-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 872.63 Pln | |
| Fluorochem | 10g | 7417.20 Pln | |
| Fluorochem | 25g | 17293.93 Pln |
| delivery time | 2-3 weeks |
|---|
2-methylsulfonyl-1-[4-(trifluoromethyl)phenyl]ethanone (CAS 386715-52-2) is a chemical compound with the molecular formula C10H9F3O3S and a molecular weight of 266.24 g/mol. IUPAC name: 2-methylsulfonyl-1-[4-(trifluoromethyl)phenyl]ethanone. InChIKey: RFYXRUBKCQDSQT-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3S |
|---|---|
| Molecular weight | 266.24 g/mol |
| IUPAC name | 2-methylsulfonyl-1-[4-(trifluoromethyl)phenyl]ethanone |
| InChIKey | RFYXRUBKCQDSQT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)