CAS 386715-52-2 appears in our catalog under these names: 2-Methylsulfonyl-1-(4-trifluoromethylphenyl)ethanone, 95%, 2-(Methylsulfonyl)-1-[4-(trifluoromethyl)phenyl]ethanone, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 10g, 25g, 5g.
2-methylsulfonyl-1-[4-(trifluoromethyl)phenyl]ethanone (CAS 386715-52-2) is a chemical compound with the molecular formula C10H9F3O3S and a molecular weight of 266.24 g/mol. IUPAC name: 2-methylsulfonyl-1-[4-(trifluoromethyl)phenyl]ethanone. InChIKey: RFYXRUBKCQDSQT-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3S |
|---|---|
| Molecular weight | 266.24 g/mol |
| IUPAC name | 2-methylsulfonyl-1-[4-(trifluoromethyl)phenyl]ethanone |
| InChIKey | RFYXRUBKCQDSQT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)