cas: 63735-42-2 — see every product listed under this CAS number, including other names
2-Naphthalenesulfinic acid, sodium salt, 95%, 95% (CAS 63735-42-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12C96O-100mg |
| cas | 63735-42-2 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 635.60 Pln | |
| Chemat | 5g | 1782.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Sodium naphthalene-2-sulfinate (CAS 63735-42-2) is a chemical compound with the molecular formula C10H7NaO2S and a molecular weight of 214.22 g/mol. IUPAC name: sodium naphthalene-2-sulfinate. InChIKey: JGGFVSGYTHUAOQ-UHFFFAOYSA-M.
| Molecular formula | C10H7NaO2S |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | sodium naphthalene-2-sulfinate |
| InChIKey | JGGFVSGYTHUAOQ-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)