CAS 63735-42-2 appears in our catalog under these names: Sodium naphthalene-2-sulfinate, 97%, 2-Naphthalenesulfinic acid sodium salt 95%, 2-Naphthalenesulfinic acid, sodium salt, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 250mg, 100mg.
Sodium naphthalene-2-sulfinate (CAS 63735-42-2) is a chemical compound with the molecular formula C10H7NaO2S and a molecular weight of 214.22 g/mol. IUPAC name: sodium naphthalene-2-sulfinate. InChIKey: JGGFVSGYTHUAOQ-UHFFFAOYSA-M.
| Molecular formula | C10H7NaO2S |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | sodium naphthalene-2-sulfinate |
| InChIKey | JGGFVSGYTHUAOQ-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)