cas: 1197236-32-0 — see every product listed under this CAS number, including other names
2-Nitro-5-(trifluoromethoxy)phenol 97% (CAS 1197236-32-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A907238-250mg |
| cas | 1197236-32-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 587.31 Pln | |
| Ambeed | 1g | 1482.88 Pln | |
| Ambeed | 5g | 4948.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A907238 |
2-nitro-5-(trifluoromethoxy)phenol (CAS 1197236-32-0) is a chemical compound with the molecular formula C7H4F3NO4 and a molecular weight of 223.11 g/mol. IUPAC name: 2-nitro-5-(trifluoromethoxy)phenol. InChIKey: MBOIPPULJYXNPE-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO4 |
|---|---|
| Molecular weight | 223.11 g/mol |
| IUPAC name | 2-nitro-5-(trifluoromethoxy)phenol |
| InChIKey | MBOIPPULJYXNPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)