CAS 1197236-32-0 appears in our catalog under these names: 2-Nitro-5-(trifluoromethoxy)phenol, 95%, 2-Nitro-5-(trifluoromethoxy)phenol 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 5g.
2-nitro-5-(trifluoromethoxy)phenol (CAS 1197236-32-0) is a chemical compound with the molecular formula C7H4F3NO4 and a molecular weight of 223.11 g/mol. IUPAC name: 2-nitro-5-(trifluoromethoxy)phenol. InChIKey: MBOIPPULJYXNPE-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO4 |
|---|---|
| Molecular weight | 223.11 g/mol |
| IUPAC name | 2-nitro-5-(trifluoromethoxy)phenol |
| InChIKey | MBOIPPULJYXNPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)