cas: 433-98-7 — see every product listed under this CAS number, including other names
2-Nitro-benzenesulfonyl fluoride, 97% (CAS 433-98-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F032938-1G |
| cas | 433-98-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 10g | 310.33 Pln | |
| Fluorochem | 25g | 482.14 Pln | |
| Fluorochem | 100g | 1736.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-nitrobenzenesulfonyl fluoride (CAS 433-98-7) is a chemical compound with the molecular formula C6H4FNO4S and a molecular weight of 205.17 g/mol. IUPAC name: 2-nitrobenzenesulfonyl fluoride. InChIKey: HSQIQAVSSNKMBM-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO4S |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 2-nitrobenzenesulfonyl fluoride |
| InChIKey | HSQIQAVSSNKMBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])S(=O)(=O)F |
Computed by PubChem (NCBI)