CAS 349-78-0 appears in our catalog under these names: 3-Nitrobenzenesulfonyl fluoride, 97%, 3-Nitrobenzenesulphonyl fluoride, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 100g, 25g, 5g, 1g.
3-nitrobenzenesulfonyl fluoride (CAS 349-78-0) is a chemical compound with the molecular formula C6H4FNO4S and a molecular weight of 205.17 g/mol. IUPAC name: 3-nitrobenzenesulfonyl fluoride. InChIKey: CWFLJNDQTKMBAM-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO4S |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 3-nitrobenzenesulfonyl fluoride |
| InChIKey | CWFLJNDQTKMBAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)