cas: 6157-98-8 — see every product listed under this CAS number, including other names
2-Nitrotetrafluoroaniline, ≥95%, ≥95% (CAS 6157-98-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EKON-50mg |
| cas | 6157-98-8 |
| size | 50mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 242.00 Pln | |
| Chemat | 250mg | 630.80 Pln | |
| Chemat | 1g | 1840.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2,3,4,5-tetrafluoro-6-nitroaniline (CAS 6157-98-8) is a chemical compound with the molecular formula C6H2F4N2O2 and a molecular weight of 210.09 g/mol. IUPAC name: 2,3,4,5-tetrafluoro-6-nitroaniline. InChIKey: ZXGOZLMDKSUORL-UHFFFAOYSA-N.
| Molecular formula | C6H2F4N2O2 |
|---|---|
| Molecular weight | 210.09 g/mol |
| IUPAC name | 2,3,4,5-tetrafluoro-6-nitroaniline |
| InChIKey | ZXGOZLMDKSUORL-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)[N+](=O)[O-])N |
Computed by PubChem (NCBI)