CAS 1806894-57-4 is the registry number for 4-(Difluoromethyl)-3,5-difluoro-2-nitropyridine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(difluoromethyl)-3,5-difluoro-2-nitropyridine (CAS 1806894-57-4) is a chemical compound with the molecular formula C6H2F4N2O2 and a molecular weight of 210.09 g/mol. IUPAC name: 4-(difluoromethyl)-3,5-difluoro-2-nitropyridine. InChIKey: RXRIWSBCAPHLTK-UHFFFAOYSA-N.
| Molecular formula | C6H2F4N2O2 |
|---|---|
| Molecular weight | 210.09 g/mol |
| IUPAC name | 4-(difluoromethyl)-3,5-difluoro-2-nitropyridine |
| InChIKey | RXRIWSBCAPHLTK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)[N+](=O)[O-])F)C(F)F)F |
Computed by PubChem (NCBI)