cas: 1951439-79-4 — see every product listed under this CAS number, including other names
2-PHenyl-2,5,6,7-tetrahydro-pyrazolo(4,3-b)pyridine-4-carboxylic acid tert-butyl ester, 95% (CAS 1951439-79-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A757141-1g |
| cas | 1951439-79-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 8109.85 Pln | |
| AmBeed | 5g | 30452.17 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 2-phenyl-6,7-dihydro-5H-pyrazolo[4,3-b]pyridine-4-carboxylate (CAS 1951439-79-4) is a chemical compound with the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. IUPAC name: tert-butyl 2-phenyl-6,7-dihydro-5H-pyrazolo[4,3-b]pyridine-4-carboxylate. InChIKey: OSXGZSLQHVTFMD-UHFFFAOYSA-N.
| Molecular formula | C17H21N3O2 |
|---|---|
| Molecular weight | 299.37 g/mol |
| IUPAC name | tert-butyl 2-phenyl-6,7-dihydro-5H-pyrazolo[4,3-b]pyridine-4-carboxylate |
| InChIKey | OSXGZSLQHVTFMD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=NN(C=C21)C3=CC=CC=C3 |
Computed by PubChem (NCBI)