Products 1206970-41-3

CAS 1206970-41-3 is the registry number for 4-(1-(2-(Piperidin-1-yl)ethyl)-1h-pyrazol-4-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.

Structural formula: {0} (CAS {1})

4-[1-(2-piperidin-1-ylethyl)pyrazol-4-yl]benzoic acid (CAS 1206970-41-3) is a chemical compound with the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. IUPAC name: 4-[1-(2-piperidin-1-ylethyl)pyrazol-4-yl]benzoic acid. InChIKey: UZPQHCRLANDWGC-UHFFFAOYSA-N.

Identity
Molecular formulaC17H21N3O2
Molecular weight299.37 g/mol
IUPAC name4-[1-(2-piperidin-1-ylethyl)pyrazol-4-yl]benzoic acid
InChIKeyUZPQHCRLANDWGC-UHFFFAOYSA-N
SMILESC1CCN(CC1)CCN2C=C(C=N2)C3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)