cas: 40452-20-8 — see every product listed under this CAS number, including other names
2-Phenanthrenecarboxylicacid, 95%, 95% (CAS 40452-20-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149QI-100mg |
| cas | 40452-20-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 549.20 Pln | |
| Chemat | 250mg | 630.80 Pln | |
| Chemat | 1g | 1302.80 Pln | |
| Chemat | 5g | 4197.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Phenanthrene-2-carboxylic acid (CAS 40452-20-8) is a chemical compound with the molecular formula C15H10O2 and a molecular weight of 222.24 g/mol. IUPAC name: phenanthrene-2-carboxylic acid. InChIKey: QTWYUOSZMIWHJV-UHFFFAOYSA-N.
| Molecular formula | C15H10O2 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | phenanthrene-2-carboxylic acid |
| InChIKey | QTWYUOSZMIWHJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)