CAS 957768-42-2 is the registry number for (3,4-Methylenedioxy-phenyl)phenylacetylene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
5-(2-phenylethynyl)-1,3-benzodioxole (CAS 957768-42-2) is a chemical compound with the molecular formula C15H10O2 and a molecular weight of 222.24 g/mol. IUPAC name: 5-(2-phenylethynyl)-1,3-benzodioxole. InChIKey: KUKWOOHRPSHQEC-UHFFFAOYSA-N.
| Molecular formula | C15H10O2 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 5-(2-phenylethynyl)-1,3-benzodioxole |
| InChIKey | KUKWOOHRPSHQEC-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C#CC3=CC=CC=C3 |
Computed by PubChem (NCBI)