2-Phenoxyacetohydrazide, 96%, 96%
cas: 4664-55-5 — see every product listed under this CAS number, including other names
2-Phenoxyacetohydrazide, 96%, 96% (CAS 4664-55-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D9UR-250mg |
| cas | 4664-55-5 |
| size | 250mg |
| availability | 300g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 347.60 Pln | |
| Chemat | 10g | 635.60 Pln | |
| Chemat | 25g | 1173.20 Pln | |
| Chemat | 100g | 4504.40 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-phenoxyacetohydrazide (CAS 4664-55-5) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2-phenoxyacetohydrazide. InChIKey: XSONSBDQIFBIOY-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2-phenoxyacetohydrazide |
| InChIKey | XSONSBDQIFBIOY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC(=O)NN |
Computed by PubChem (NCBI)
Synonyms:
2-Phenoxyacetohydrazide, XSONSBDQIFBIOY-UHFFFAOYSA-, InChI=1/C8H10N2O2/c9-10-8(11)6-12-7-4-2-1-3-5-7/h1-5H,6,9H2,(H,10,11), Phenoxyacetic acid hydrazide, Acetic acid, phenoxy-, hydrazide, Phenoxy-Acetic Acid Hydrazide, PHENOXYACETOHYDRAZIDE, Maybridge4_003484, 2-Phenoxyacetohydrazide #, Cambridge id 5153128