2-Phenoxypyridin-4-amine, 95%
cas: 21203-83-8 — see every product listed under this CAS number, including other names
2-Phenoxypyridin-4-amine, 95% (CAS 21203-83-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 5g, 250mg. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | HB-4381-1g |
| cas | 21203-83-8 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1232.56 Pln | |
| Ambeed | 5g | 3680.06 Pln | |
| BLDpharm | 100mg | 314.36 Pln | |
| BLDpharm | 250mg | 547.61 Pln | |
| BLDpharm | 1g | 1325.11 Pln | |
| BLDpharm | 5g | 3963.07 Pln | |
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 544.40 Pln | |
| Chemat | 1g | 1274.00 Pln | |
| Chemat | 5g | 3698.00 Pln | |
| Fluorochem | 100mg | 544.62 Pln | |
| Fluorochem | 250mg | 992.38 Pln | |
| Fluorochem | 1g | 2361.69 Pln | |
| Fluorochem | 5g | 6729.94 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-phenoxypyridin-4-amine (CAS 21203-83-8) is a chemical compound with the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. IUPAC name: 2-phenoxypyridin-4-amine. InChIKey: OFTDZLLFZKPIIT-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 2-phenoxypyridin-4-amine |
| InChIKey | OFTDZLLFZKPIIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NC=CC(=C2)N |
Computed by PubChem (NCBI)