CAS 52816-65-6 appears in our catalog under these names: 3-Acetyl-2-methyl-1,6-naphthyridine, 95%, 1-(2-Methyl-1,6-naphthyridin-3-yl)ethanone, 95+%, 3-Acetyl-2-methyl-1,6-naphthyridine. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
1-(2-methyl-1,6-naphthyridin-3-yl)ethanone (CAS 52816-65-6) is a chemical compound with the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. IUPAC name: 1-(2-methyl-1,6-naphthyridin-3-yl)ethanone. InChIKey: IKNXDFVOTFRCCA-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 1-(2-methyl-1,6-naphthyridin-3-yl)ethanone |
| InChIKey | IKNXDFVOTFRCCA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C=NC=CC2=N1)C(=O)C |
Computed by PubChem (NCBI)