cas: 502653-18-1 — see every product listed under this CAS number, including other names
2-Phenyl-1-(piperazin-1-yl)ethanone hydrochloride 95% (CAS 502653-18-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A166623-250mg |
| cas | 502653-18-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 681.88 Pln | |
| Ambeed | 1g | 1538.50 Pln | |
| Ambeed | 5g | 3746.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A166623 |
2-phenyl-1-piperazin-1-ylethanone;hydrochloride (CAS 502653-18-1) is a chemical compound with the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. IUPAC name: 2-phenyl-1-piperazin-1-ylethanone;hydrochloride. InChIKey: KZFZUNOXEDDALC-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O |
|---|---|
| Molecular weight | 240.73 g/mol |
| IUPAC name | 2-phenyl-1-piperazin-1-ylethanone;hydrochloride |
| InChIKey | KZFZUNOXEDDALC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)