cas: 502653-18-1 — see every product listed under this CAS number, including other names
2-Phenyl-1-(piperazin-1-yl)ethanone hydrochloride (CAS 502653-18-1) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DLPQ-10mg |
| cas | 502653-18-1 |
| size | 10mg |
| availability | 0.05g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 194.00 Pln | |
| Chemat | 50mg | 352.40 Pln |
| delivery time | 3 weeks |
|---|
2-phenyl-1-piperazin-1-ylethanone;hydrochloride (CAS 502653-18-1) is a chemical compound with the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. IUPAC name: 2-phenyl-1-piperazin-1-ylethanone;hydrochloride. InChIKey: KZFZUNOXEDDALC-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O |
|---|---|
| Molecular weight | 240.73 g/mol |
| IUPAC name | 2-phenyl-1-piperazin-1-ylethanone;hydrochloride |
| InChIKey | KZFZUNOXEDDALC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)