cas: 1171476-07-5 — see every product listed under this CAS number, including other names
2-Phenyl-4,5,6,7-tetrahydro-2H-pyrazolo(4,3-c)pyridine dihydrochloride, 95+% (CAS 1171476-07-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A836496-250mg |
| cas | 1171476-07-5 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 2166.22 Pln | |
| AmBeed | 1g | 5310.55 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-phenyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine;hydrochloride (CAS 1171476-07-5) is a chemical compound with the molecular formula C12H14ClN3 and a molecular weight of 235.71 g/mol. IUPAC name: 2-phenyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine;hydrochloride. InChIKey: TZUIXGOGVZQKBD-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3 |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 2-phenyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine;hydrochloride |
| InChIKey | TZUIXGOGVZQKBD-UHFFFAOYSA-N |
| SMILES | C1CNCC2=CN(N=C21)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)