CAS 1573548-40-9 is the registry number for 2-Chloro-5-((3,5-dimethyl-1H-pyrazol-1-yl)methyl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-5-[(3,5-dimethylpyrazol-1-yl)methyl]aniline (CAS 1573548-40-9) is a chemical compound with the molecular formula C12H14ClN3 and a molecular weight of 235.71 g/mol. IUPAC name: 2-chloro-5-[(3,5-dimethylpyrazol-1-yl)methyl]aniline. InChIKey: CJVHQAJLHSHCRM-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3 |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 2-chloro-5-[(3,5-dimethylpyrazol-1-yl)methyl]aniline |
| InChIKey | CJVHQAJLHSHCRM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CC2=CC(=C(C=C2)Cl)N)C |
Computed by PubChem (NCBI)