cas: 280110-78-3 — see every product listed under this CAS number, including other names
2-Phenyl-5-(piperidin-4-yl)-1,3,4-oxadiazole 98% (CAS 280110-78-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A533924-250mg |
| cas | 280110-78-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 2061.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A533924 |
2-phenyl-5-piperidin-4-yl-1,3,4-oxadiazole (CAS 280110-78-3) is a chemical compound with the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. IUPAC name: 2-phenyl-5-piperidin-4-yl-1,3,4-oxadiazole. InChIKey: HGVYYGIMDHYGFJ-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O |
|---|---|
| Molecular weight | 229.28 g/mol |
| IUPAC name | 2-phenyl-5-piperidin-4-yl-1,3,4-oxadiazole |
| InChIKey | HGVYYGIMDHYGFJ-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=NN=C(O2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)