cas: 280110-78-3 — see every product listed under this CAS number, including other names
4-(5-Phenyl-1,3,4-oxadiazol-2-yl)piperidine (CAS 280110-78-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023791-250MG |
| cas | 280110-78-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 549.82 Pln | |
| Fluorochem | 5g | 1611.95 Pln |
| delivery time | 2-3 weeks |
|---|
2-phenyl-5-piperidin-4-yl-1,3,4-oxadiazole (CAS 280110-78-3) is a chemical compound with the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. IUPAC name: 2-phenyl-5-piperidin-4-yl-1,3,4-oxadiazole. InChIKey: HGVYYGIMDHYGFJ-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O |
|---|---|
| Molecular weight | 229.28 g/mol |
| IUPAC name | 2-phenyl-5-piperidin-4-yl-1,3,4-oxadiazole |
| InChIKey | HGVYYGIMDHYGFJ-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=NN=C(O2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)