2-Phenylchroman-5,7-diol, 95%
cas: 493-43-6 — see every product listed under this CAS number, including other names
2-Phenylchroman-5,7-diol, 95% (CAS 493-43-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A320383-250mg |
| cas | 493-43-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1510.69 Pln | |
| Ambeed | 1g | 3869.19 Pln | |
| Chemat | 50mg | 515.60 Pln | |
| Chemat | 100mg | 837.20 Pln | |
| Chemat | 250mg | 1374.80 Pln | |
| Chemat | 1g | 3606.80 Pln | |
| BLDpharm | 50mg | 603.15 Pln | |
| BLDpharm | 100mg | 964.13 Pln | |
| BLDpharm | 250mg | 1619.45 Pln | |
| BLDpharm | 1g | 4168.56 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-phenyl-3,4-dihydro-2H-chromene-5,7-diol (CAS 493-43-6) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-phenyl-3,4-dihydro-2H-chromene-5,7-diol. InChIKey: YFLAFNQHWRFTGP-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-phenyl-3,4-dihydro-2H-chromene-5,7-diol |
| InChIKey | YFLAFNQHWRFTGP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2OC1C3=CC=CC=C3)O)O |
Computed by PubChem (NCBI)