cas: 1187822-25-8 — see every product listed under this CAS number, including other names
2-Phenylimidazo[1,2-a]pyridin-6-ylboronic acid, 97% (CAS 1187822-25-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F623773-100MG |
| cas | 1187822-25-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2913.58 Pln | |
| Fluorochem | 1g | 3970.49 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2-phenylimidazo[1,2-a]pyridin-6-yl)boronic acid (CAS 1187822-25-8) is a chemical compound with the molecular formula C13H11BN2O2 and a molecular weight of 238.05 g/mol. IUPAC name: (2-phenylimidazo[1,2-a]pyridin-6-yl)boronic acid. InChIKey: DLVLGGPKNQEEKJ-UHFFFAOYSA-N.
| Molecular formula | C13H11BN2O2 |
|---|---|
| Molecular weight | 238.05 g/mol |
| IUPAC name | (2-phenylimidazo[1,2-a]pyridin-6-yl)boronic acid |
| InChIKey | DLVLGGPKNQEEKJ-UHFFFAOYSA-N |
| SMILES | B(C1=CN2C=C(N=C2C=C1)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)