cas: 62375-96-6 — see every product listed under this CAS number, including other names
2-Propen-1-one, 1,3-bis(4-fluorophenyl)-3-hydroxy-, 95%, 95% (CAS 62375-96-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12I1HT-100mg |
| cas | 62375-96-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1576.40 Pln | |
| Chemat | 1g | 3165.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,3-bis(4-fluorophenyl)-3-hydroxyprop-2-en-1-one (CAS 62375-96-6) is a chemical compound with the molecular formula C15H10F2O2 and a molecular weight of 260.23 g/mol. IUPAC name: 1,3-bis(4-fluorophenyl)-3-hydroxyprop-2-en-1-one. InChIKey: WYHRBBCFYJXBRN-UHFFFAOYSA-N.
| Molecular formula | C15H10F2O2 |
|---|---|
| Molecular weight | 260.23 g/mol |
| IUPAC name | 1,3-bis(4-fluorophenyl)-3-hydroxyprop-2-en-1-one |
| InChIKey | WYHRBBCFYJXBRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=CC(=O)C2=CC=C(C=C2)F)O)F |
Computed by PubChem (NCBI)