CAS 62375-96-6 appears in our catalog under these names: 2-Propen-1-one, 1,3-bis(4-fluorophenyl)-3-hydroxy-, 95%, 2-Propen-1-one, 1,3-bis(4-fluorophenyl)-3-hydroxy-, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
1,3-bis(4-fluorophenyl)-3-hydroxyprop-2-en-1-one (CAS 62375-96-6) is a chemical compound with the molecular formula C15H10F2O2 and a molecular weight of 260.23 g/mol. IUPAC name: 1,3-bis(4-fluorophenyl)-3-hydroxyprop-2-en-1-one. InChIKey: WYHRBBCFYJXBRN-UHFFFAOYSA-N.
| Molecular formula | C15H10F2O2 |
|---|---|
| Molecular weight | 260.23 g/mol |
| IUPAC name | 1,3-bis(4-fluorophenyl)-3-hydroxyprop-2-en-1-one |
| InChIKey | WYHRBBCFYJXBRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=CC(=O)C2=CC=C(C=C2)F)O)F |
Computed by PubChem (NCBI)