cas: 1073371-96-6 — see every product listed under this CAS number, including other names
2-fluoro-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%, 98% (CAS 1073371-96-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1195VO-100mg |
| cas | 1073371-96-6 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 500mg | 246.80 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 914.00 Pln | |
| Chemat | 25g | 2891.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1073371-96-6) is a chemical compound with the molecular formula C12H17BFNO2 and a molecular weight of 237.08 g/mol. IUPAC name: 2-fluoro-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: VQBAQPBHXGGKBZ-UHFFFAOYSA-N.
| Molecular formula | C12H17BFNO2 |
|---|---|
| Molecular weight | 237.08 g/mol |
| IUPAC name | 2-fluoro-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | VQBAQPBHXGGKBZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2F)C |
Computed by PubChem (NCBI)