cas: 42772-85-0 — see every product listed under this CAS number, including other names
2-hydroxyethyl 4-methylbenzenesulfonate, 98%, 98% (CAS 42772-85-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CMTO-100mg |
| cas | 42772-85-0 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 1576.40 Pln | |
| Chemat | 10g | 2541.20 Pln | |
| Chemat | 25g | 4749.20 Pln | |
| Chemat | 50g | 5589.20 Pln | |
| Chemat | 100g | 9285.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-hydroxyethyl 4-methylbenzenesulfonate (CAS 42772-85-0) is a chemical compound with the molecular formula C9H12O4S and a molecular weight of 216.26 g/mol. IUPAC name: 2-hydroxyethyl 4-methylbenzenesulfonate. InChIKey: DZVSAHOHDQUFMZ-UHFFFAOYSA-N.
| Molecular formula | C9H12O4S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 2-hydroxyethyl 4-methylbenzenesulfonate |
| InChIKey | DZVSAHOHDQUFMZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCO |
Computed by PubChem (NCBI)