cas: 42772-85-0 — see every product listed under this CAS number, including other names
Ethylene Glycol Monotosylate 95% (CAS 42772-85-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A989220-100mg |
| cas | 42772-85-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1199.19 Pln | |
| Ambeed | 5g | 4019.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A989220 |
2-hydroxyethyl 4-methylbenzenesulfonate (CAS 42772-85-0) is a chemical compound with the molecular formula C9H12O4S and a molecular weight of 216.26 g/mol. IUPAC name: 2-hydroxyethyl 4-methylbenzenesulfonate. InChIKey: DZVSAHOHDQUFMZ-UHFFFAOYSA-N.
| Molecular formula | C9H12O4S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 2-hydroxyethyl 4-methylbenzenesulfonate |
| InChIKey | DZVSAHOHDQUFMZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCO |
Computed by PubChem (NCBI)