TBADN 97% (CAS 274905-73-6) manufactured by Ambeed in a 100mg pack.
| brand | Ambeed |
|---|---|
| catalog number | A759967-100mg |
| cas | 274905-73-6 |
| size | 100mg |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A759967 |
2-tert-butyl-9,10-dinaphthalen-2-ylanthracene (CAS 274905-73-6) is a chemical compound with the molecular formula C38H30 and a molecular weight of 486.6 g/mol. IUPAC name: 2-tert-butyl-9,10-dinaphthalen-2-ylanthracene. InChIKey: OBAJPWYDYFEBTF-UHFFFAOYSA-N.
| Molecular formula | C38H30 |
|---|---|
| Molecular weight | 486.6 g/mol |
| IUPAC name | 2-tert-butyl-9,10-dinaphthalen-2-ylanthracene |
| InChIKey | OBAJPWYDYFEBTF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C3=CC=CC=C3C(=C2C=C1)C4=CC5=CC=CC=C5C=C4)C6=CC7=CC=CC=C7C=C6 |
Computed by PubChem (NCBI)