cas: 886469-23-4 — see every product listed under this CAS number, including other names
23-Hydroxy-3,6,9,12,15,18,21-heptaoxatricosyl 4-methylbenzenesulfonate, 98% (CAS 886469-23-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F867238-250MG |
| cas | 886469-23-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 393.63 Pln | |
| Fluorochem | 5g | 1695.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 886469-23-4) is a chemical compound with the molecular formula C23H40O11S and a molecular weight of 524.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: WJRLJFKBPYKOHJ-UHFFFAOYSA-N.
| Molecular formula | C23H40O11S |
|---|---|
| Molecular weight | 524.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | WJRLJFKBPYKOHJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)