CAS 886469-23-4 appears in our catalog under these names: 23-Hydroxy-3,6,9,12,15,18,21-heptaoxatricosyl 4-methylbenzenesulfonate, 98%, 23-Hydroxy-3,6,9,12,15,18,21-heptaoxatricosyl 4-methylbenzenesulfonate, 98%, 98%, Peg9-ots, 95%, PEG8–Tos, PEG8-Tos 95%. Offered by: Fluorochem, Chemat, Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg, 250 mg, 5 g, 500 mg.
2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 886469-23-4) is a chemical compound with the molecular formula C23H40O11S and a molecular weight of 524.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: WJRLJFKBPYKOHJ-UHFFFAOYSA-N.
| Molecular formula | C23H40O11S |
|---|---|
| Molecular weight | 524.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | WJRLJFKBPYKOHJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)