cas: 188783-78-0 — see every product listed under this CAS number, including other names
2F-Peracetyl-Fucose 97% (CAS 188783-78-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A423089-100mg |
| cas | 188783-78-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 698.56 Pln | |
| Ambeed | 250mg | 1110.19 Pln | |
| Ambeed | 1g | 2161.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A423089 |
[(2S,3R,4R,5S)-4,6-diacetyloxy-5-fluoro-2-methyloxan-3-yl] acetate (CAS 188783-78-0) is a chemical compound with the molecular formula C12H17FO7 and a molecular weight of 292.26 g/mol. IUPAC name: [(2S,3R,4R,5S)-4,6-diacetyloxy-5-fluoro-2-methyloxan-3-yl] acetate. InChIKey: QFVJLBVULJFLKN-VLCHEQJQSA-N.
| Molecular formula | C12H17FO7 |
|---|---|
| Molecular weight | 292.26 g/mol |
| IUPAC name | [(2S,3R,4R,5S)-4,6-diacetyloxy-5-fluoro-2-methyloxan-3-yl] acetate |
| InChIKey | QFVJLBVULJFLKN-VLCHEQJQSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H](C(O1)OC(=O)C)F)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)