2F-Peracetyl-Fucose, 98%
cas: 188783-78-0 — see every product listed under this CAS number, including other names
2F-Peracetyl-Fucose, 98% (CAS 188783-78-0) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F983735-25MG |
| cas | 188783-78-0 |
| size | 25mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 549.82 Pln | |
| Fluorochem | 50mg | 607.10 Pln | |
| Fluorochem | 100mg | 664.37 Pln | |
| Fluorochem | 250mg | 1060.06 Pln | |
| Fluorochem | 1g | 2101.36 Pln | |
| Fluorochem | 5g | 6355.07 Pln | |
| Fluorochem | 10g | 10587.96 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[(2S,3R,4R,5S)-4,6-diacetyloxy-5-fluoro-2-methyloxan-3-yl] acetate (CAS 188783-78-0) is a chemical compound with the molecular formula C12H17FO7 and a molecular weight of 292.26 g/mol. IUPAC name: [(2S,3R,4R,5S)-4,6-diacetyloxy-5-fluoro-2-methyloxan-3-yl] acetate. InChIKey: QFVJLBVULJFLKN-VLCHEQJQSA-N.
| Molecular formula | C12H17FO7 |
|---|---|
| Molecular weight | 292.26 g/mol |
| IUPAC name | [(2S,3R,4R,5S)-4,6-diacetyloxy-5-fluoro-2-methyloxan-3-yl] acetate |
| InChIKey | QFVJLBVULJFLKN-VLCHEQJQSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H](C(O1)OC(=O)C)F)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
2F-Peracetyl-Fucose, (3S,4R,5R,6S)-3-Fluoro-6-methyltetrahydro-2H-pyran-2,4,5-triyl triacetate, [(2S,3R,4R,5S)-4,6-Diacetyloxy-5-fluoro-2-methyloxan-3-yl] acetate, [(2S,3R,4R,5S)-4,6-Diacetoxy-5-fluoro-2-methyl-tetrahydropyran-3-yl] acetate, L-Galactopyranose, 2,6-dideoxy-2-fluoro-, triacetate, 2,6-Dideoxy-2-fluoro-L-galactopyranose 1,3,4-Triacetate, 2-Deoxy-2-fluoro-1,3,4-tri-O-acetyl-alpha,beta-L-fucopyranose, Peracetylated 2-fluoro 2-deoxy-L-fucose, 1,3,4-Tri-O-acetyl-2-deoxy-2-fluoro-L-fucose, 1,3,4-Tri-O-acetyl-2-deoxy-2-fluoro-L-fucopyranose