cas: 842977-15-5 — see every product listed under this CAS number, including other names
2H-(3,4'-Bi(1,2,4-triazole))-5-carboxylic acid, 98% (CAS 842977-15-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1435403-5g |
| cas | 842977-15-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 13864.69 Pln | |
| AmBeed | 10g | 22496.95 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazole-5-carboxylic acid (CAS 842977-15-5) is a chemical compound with the molecular formula C5H4N6O2 and a molecular weight of 180.12 g/mol. IUPAC name: 3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazole-5-carboxylic acid. InChIKey: GRTDCIJKOJDFER-UHFFFAOYSA-N.
| Molecular formula | C5H4N6O2 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazole-5-carboxylic acid |
| InChIKey | GRTDCIJKOJDFER-UHFFFAOYSA-N |
| SMILES | C1=NN=CN1C2=NNC(=N2)C(=O)O |
Computed by PubChem (NCBI)