CAS 842977-15-5 appears in our catalog under these names: 2H-3,4'-Bi-1,2,4-triazole-5-carboxylic acid, 95%, 2H-(3,4'-Bi(1,2,4-triazole))-5-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 10g.
3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazole-5-carboxylic acid (CAS 842977-15-5) is a chemical compound with the molecular formula C5H4N6O2 and a molecular weight of 180.12 g/mol. IUPAC name: 3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazole-5-carboxylic acid. InChIKey: GRTDCIJKOJDFER-UHFFFAOYSA-N.
| Molecular formula | C5H4N6O2 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazole-5-carboxylic acid |
| InChIKey | GRTDCIJKOJDFER-UHFFFAOYSA-N |
| SMILES | C1=NN=CN1C2=NNC(=N2)C(=O)O |
Computed by PubChem (NCBI)