cas: 877179-04-9 — see every product listed under this CAS number, including other names
3',4'-Dichloro-5-fluoro-[1,1'-biphenyl]-2-amine 95% (CAS 877179-04-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A199904-1g |
| cas | 877179-04-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 25g | 1421.69 Pln | |
| Ambeed | 100g | 5426.69 Pln | |
| Ambeed | 5g | 464.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A199904 |
2-(3,4-dichlorophenyl)-4-fluoroaniline (CAS 877179-04-9) is a chemical compound with the molecular formula C12H8Cl2FN and a molecular weight of 256.10 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-4-fluoroaniline. InChIKey: QUVGVAKQHNJQNN-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2FN |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-4-fluoroaniline |
| InChIKey | QUVGVAKQHNJQNN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=C(C=CC(=C2)F)N)Cl)Cl |
Computed by PubChem (NCBI)