CAS 877179-04-9 appears in our catalog under these names: 3',4'-Dichloro-5-fluoro-[1,1'-biphenyl]-2-amine, 95%, 2–(3,4–Dichlorophenyl)–4–fluoroaniline, 3',4'-Dichloro-5-fluorobiphenyl-2-amine, 3',4'-Dichloro-5-fluoro-[1,1'-biphenyl]-2-amine 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 50mg, 0,5g, 0,25g, 2g, 25g.
2-(3,4-dichlorophenyl)-4-fluoroaniline (CAS 877179-04-9) is a chemical compound with the molecular formula C12H8Cl2FN and a molecular weight of 256.10 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-4-fluoroaniline. InChIKey: QUVGVAKQHNJQNN-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2FN |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-4-fluoroaniline |
| InChIKey | QUVGVAKQHNJQNN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=C(C=CC(=C2)F)N)Cl)Cl |
Computed by PubChem (NCBI)