cas: 160521-46-0 — see every product listed under this CAS number, including other names
3'-Bromo-[1,1'-biphenyl]-4-carbonitrile 98% (CAS 160521-46-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A469976-5g |
| cas | 160521-46-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 503.88 Pln | |
| Ambeed | 25g | 2111.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A469976 |
4-(3-bromophenyl)benzonitrile (CAS 160521-46-0) is a chemical compound with the molecular formula C13H8BrN and a molecular weight of 258.11 g/mol. IUPAC name: 4-(3-bromophenyl)benzonitrile. InChIKey: ZGHLPFNAHBELBC-UHFFFAOYSA-N.
| Molecular formula | C13H8BrN |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 4-(3-bromophenyl)benzonitrile |
| InChIKey | ZGHLPFNAHBELBC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)