CAS 17613-40-0 appears in our catalog under these names: 6-Bromophenanthridine, 95%, 6-Bromophenanthridine, 97%, 97%, 6-Bromophenanthridine, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-bromophenanthridine (CAS 17613-40-0) is a chemical compound with the molecular formula C13H8BrN and a molecular weight of 258.11 g/mol. IUPAC name: 6-bromophenanthridine. InChIKey: GMWZNUNCVLSUGP-UHFFFAOYSA-N.
| Molecular formula | C13H8BrN |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 6-bromophenanthridine |
| InChIKey | GMWZNUNCVLSUGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N=C2Br |
Computed by PubChem (NCBI)