cas: 189763-65-3 — see every product listed under this CAS number, including other names
3'-Fluoro-4'-morpholinoacetophenone, 95%, 95% (CAS 189763-65-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113DYC-100mg |
| cas | 189763-65-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 842.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(3-fluoro-4-morpholin-4-ylphenyl)ethanone (CAS 189763-65-3) is a chemical compound with the molecular formula C12H14FNO2 and a molecular weight of 223.24 g/mol. IUPAC name: 1-(3-fluoro-4-morpholin-4-ylphenyl)ethanone. InChIKey: KIMOECSFZWTBMK-UHFFFAOYSA-N.
| Molecular formula | C12H14FNO2 |
|---|---|
| Molecular weight | 223.24 g/mol |
| IUPAC name | 1-(3-fluoro-4-morpholin-4-ylphenyl)ethanone |
| InChIKey | KIMOECSFZWTBMK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)N2CCOCC2)F |
Computed by PubChem (NCBI)