3'-Fluoroacetanilide, 98%
cas: 351-28-0 — see every product listed under this CAS number, including other names
3'-Fluoroacetanilide, 98% (CAS 351-28-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g, 250g, 5g, 500g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F006174-1G |
| cas | 351-28-0 |
| size | 1g |
| availability | In Stock UK |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 25g | 299.91 Pln | |
| Fluorochem | 100g | 310.33 Pln | |
| Fluorochem | 250g | 638.33 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1354.94 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 117.20 Pln | |
| Chemat | 100g | 290.00 Pln | |
| BLDpharm | 5g | 147.75 Pln | |
| BLDpharm | 25g | 275.48 Pln | |
| BLDpharm | 100g | 636.47 Pln | |
| BLDpharm | 500g | 1863.81 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
N-(3-fluorophenyl)acetamide (CAS 351-28-0) is a chemical compound with the molecular formula C8H8FNO and a molecular weight of 153.15 g/mol. IUPAC name: N-(3-fluorophenyl)acetamide. InChIKey: AQLLDCFUQXGLHM-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO |
|---|---|
| Molecular weight | 153.15 g/mol |
| IUPAC name | N-(3-fluorophenyl)acetamide |
| InChIKey | AQLLDCFUQXGLHM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=CC=C1)F |
Computed by PubChem (NCBI)
Synonyms:
InChI=1/C8H8FNO/c1-6(11)10-8-4-2-3-7(9)5-8/h2-5H,1H3,(H,10,11, 3'-Fluoroacetanilide, 3-Fluoroacetanilide, m-Fluoroacetanilide, 3-Acetamido-1-fluorobenzene, Acetanilide, 3'-fluoro-, Acetamide, N-(3-fluorophenyl)-, 3'-Fluoroacetanilide, 98%, 1-fluoro-3-acetamidobenzene, N-(3-Fluorophenyl)acetamide #