cas: 105112-76-3 — see every product listed under this CAS number, including other names
3,3'-((1,1'-Biphenyl)-4,4'-diylbis(oxy))dianiline, 95-<97% (CAS 105112-76-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC4180-95-97-25g |
| cas | 105112-76-3 |
| size | 25g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 25g | 5265.26 Pln | |
| Hoffman Fine Chemicals | 50g | 8238.34 Pln | |
| Hoffman Fine Chemicals | 100g | 12997.82 Pln | |
| Hoffman Fine Chemicals | 200g | 20615.54 Pln | |
| Hoffman Fine Chemicals | 300g | 27722.86 Pln | |
| Hoffman Fine Chemicals | 400g | 33203.28 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
3-[4-[4-(3-aminophenoxy)phenyl]phenoxy]aniline (CAS 105112-76-3) is a chemical compound with the molecular formula C24H20N2O2 and a molecular weight of 368.4 g/mol. IUPAC name: 3-[4-[4-(3-aminophenoxy)phenyl]phenoxy]aniline. InChIKey: UCQABCHSIIXVOY-UHFFFAOYSA-N.
| Molecular formula | C24H20N2O2 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 3-[4-[4-(3-aminophenoxy)phenyl]phenoxy]aniline |
| InChIKey | UCQABCHSIIXVOY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)C3=CC=C(C=C3)OC4=CC=CC(=C4)N)N |
Computed by PubChem (NCBI)